C19H18ClN5O4 — CID 167981649
[2-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]-2-oxoethyl] 2-amino-6-chloropyridine-4-carboxylate (PubChem CID 167981649) has the molecular formula C19H18ClN5O4 and a molecular weight of 415.84 g/mol. Its IUPAC name is [2-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]-2-oxoethyl] 2-amino-6-chloropyridine-4-carboxylate.
| Compound Name | [2-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]-2-oxoethyl] 2-amino-6-chloropyridine-4-carboxylate |
|---|---|
| PubChem CID | 167981649 |
| Molecular Formula | C19H18ClN5O4 |
| Molecular Weight | 415.84 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | [2-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]-2-oxoethyl] 2-amino-6-chloropyridine-4-carboxylate |
| SMILES | Cc1c(NC(=O)COC(=O)c2cc(N)nc(Cl)c2)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C19H18ClN5O4/c1-11-17(18(27)25(24(11)2)13-6-4-3-5-7-13)23-16(26)10-29-19(28)12-8-14(20)22-15(21)9-12/h3-9H,10H2,1-2H3,(H2,21,22)(H,23,26) |
| InChIKey | KSDCHKHTGZFKEI-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 121.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.84 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|