C22H19Cl2N3O4 — CID 6219881
[2-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]-2-oxoethyl] (E)-3-(3,4-dichlorophenyl)prop-2-enoate (PubChem CID 6219881) has the molecular formula C22H19Cl2N3O4 and a molecular weight of 460.32 g/mol. Its IUPAC name is [2-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]-2-oxoethyl] (E)-3-(3,4-dichlorophenyl)prop-2-enoate.
| Compound Name | [2-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]-2-oxoethyl] (E)-3-(3,4-dichlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 6219881 |
| Molecular Formula | C22H19Cl2N3O4 |
| Molecular Weight | 460.32 g/mol |
| Exact Mass | 459.08 |
| IUPAC Name | [2-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]-2-oxoethyl] (E)-3-(3,4-dichlorophenyl)prop-2-enoate |
| SMILES | Cc1c(NC(=O)COC(=O)/C=C/c2ccc(Cl)c(Cl)c2)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C22H19Cl2N3O4/c1-14-21(22(30)27(26(14)2)16-6-4-3-5-7-16)25-19(28)13-31-20(29)11-9-15-8-10-17(23)18(24)12-15/h3-12H,13H2,1-2H3,(H,25,28)/b11-9+ |
| InChIKey | WASSAANZXQFDFY-PKNBQFBNSA-N |
| XLogP | 3.99 |
| TPSA | 82.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.32 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|