C22H20BrN3O4 — CID 6213261
[2-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]-2-oxoethyl] (E)-3-(3-bromophenyl)prop-2-enoate (PubChem CID 6213261) has the molecular formula C22H20BrN3O4 and a molecular weight of 470.32 g/mol. Its IUPAC name is [2-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]-2-oxoethyl] (E)-3-(3-bromophenyl)prop-2-enoate.
| Compound Name | [2-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]-2-oxoethyl] (E)-3-(3-bromophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 6213261 |
| Molecular Formula | C22H20BrN3O4 |
| Molecular Weight | 470.32 g/mol |
| Exact Mass | 469.06 |
| IUPAC Name | [2-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]-2-oxoethyl] (E)-3-(3-bromophenyl)prop-2-enoate |
| SMILES | Cc1c(NC(=O)COC(=O)/C=C/c2cccc(Br)c2)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C22H20BrN3O4/c1-15-21(22(29)26(25(15)2)18-9-4-3-5-10-18)24-19(27)14-30-20(28)12-11-16-7-6-8-17(23)13-16/h3-13H,14H2,1-2H3,(H,24,27)/b12-11+ |
| InChIKey | DGGQATNKYMRVAR-VAWYXSNFSA-N |
| XLogP | 3.44 |
| TPSA | 82.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.32 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|