C19H17ClN4O4 — CID 2363869
[2-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]-2-oxoethyl] 2-chloropyridine-3-carboxylate (PubChem CID 2363869) has the molecular formula C19H17ClN4O4 and a molecular weight of 400.82 g/mol. Its IUPAC name is [2-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]-2-oxoethyl] 2-chloropyridine-3-carboxylate.
| Compound Name | [2-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]-2-oxoethyl] 2-chloropyridine-3-carboxylate |
|---|---|
| PubChem CID | 2363869 |
| Molecular Formula | C19H17ClN4O4 |
| Molecular Weight | 400.82 g/mol |
| Exact Mass | 400.09 |
| IUPAC Name | [2-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]-2-oxoethyl] 2-chloropyridine-3-carboxylate |
| SMILES | Cc1c(NC(=O)COC(=O)c2cccnc2Cl)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C19H17ClN4O4/c1-12-16(18(26)24(23(12)2)13-7-4-3-5-8-13)22-15(25)11-28-19(27)14-9-6-10-21-17(14)20/h3-10H,11H2,1-2H3,(H,22,25) |
| InChIKey | ZJQQXRTUSVQZQK-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 95.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.82 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|