C20H14ClN3 — CID 167985419
7-[3-(4-chlorophenyl)phenyl]-6-methylpyrido[2,3-b]pyrazine (PubChem CID 167985419) has the molecular formula C20H14ClN3 and a molecular weight of 331.81 g/mol. Its IUPAC name is 7-[3-(4-chlorophenyl)phenyl]-6-methylpyrido[2,3-b]pyrazine.
| Compound Name | 7-[3-(4-chlorophenyl)phenyl]-6-methylpyrido[2,3-b]pyrazine |
|---|---|
| PubChem CID | 167985419 |
| Molecular Formula | C20H14ClN3 |
| Molecular Weight | 331.81 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | 7-[3-(4-chlorophenyl)phenyl]-6-methylpyrido[2,3-b]pyrazine |
| SMILES | Cc1nc2nccnc2cc1-c1cccc(-c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C20H14ClN3/c1-13-18(12-19-20(24-13)23-10-9-22-19)16-4-2-3-15(11-16)14-5-7-17(21)8-6-14/h2-12H,1H3 |
| InChIKey | HBKJDZHLXIADIU-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.81 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |