C20H21BrN2O — CID 167985804
6-bromo-N-[2-(2-methoxy-5-methylphenyl)ethyl]-2-methylquinolin-4-amine (PubChem CID 167985804) has the molecular formula C20H21BrN2O and a molecular weight of 385.31 g/mol. Its IUPAC name is 6-bromo-N-[2-(2-methoxy-5-methylphenyl)ethyl]-2-methylquinolin-4-amine.
| Compound Name | 6-bromo-N-[2-(2-methoxy-5-methylphenyl)ethyl]-2-methylquinolin-4-amine |
|---|---|
| PubChem CID | 167985804 |
| Molecular Formula | C20H21BrN2O |
| Molecular Weight | 385.31 g/mol |
| Exact Mass | 384.08 |
| IUPAC Name | 6-bromo-N-[2-(2-methoxy-5-methylphenyl)ethyl]-2-methylquinolin-4-amine |
| SMILES | COc1ccc(C)cc1CCNc1cc(C)nc2ccc(Br)cc12 |
| InChI | InChI=1S/C20H21BrN2O/c1-13-4-7-20(24-3)15(10-13)8-9-22-19-11-14(2)23-18-6-5-16(21)12-17(18)19/h4-7,10-12H,8-9H2,1-3H3,(H,22,23) |
| InChIKey | OXBTZNOJTREZTQ-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.31 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |