C23H22N6O2 — CID 167990413
2-[[4-(2-amino-4-pyridinyl)triazol-1-yl]methyl]-N-[(1S)-2-hydroxy-1-phenylethyl]benzamide (PubChem CID 167990413) has the molecular formula C23H22N6O2 and a molecular weight of 414.47 g/mol. Its IUPAC name is 2-[[4-(2-amino-4-pyridinyl)triazol-1-yl]methyl]-N-[(1S)-2-hydroxy-1-phenylethyl]benzamide.
| Compound Name | 2-[[4-(2-amino-4-pyridinyl)triazol-1-yl]methyl]-N-[(1S)-2-hydroxy-1-phenylethyl]benzamide |
|---|---|
| PubChem CID | 167990413 |
| Molecular Formula | C23H22N6O2 |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | 2-[[4-(2-amino-4-pyridinyl)triazol-1-yl]methyl]-N-[(1S)-2-hydroxy-1-phenylethyl]benzamide |
| SMILES | Nc1cc(-c2cn(Cc3ccccc3C(=O)N[C@H](CO)c3ccccc3)nn2)ccn1 |
| InChI | InChI=1S/C23H22N6O2/c24-22-12-17(10-11-25-22)20-14-29(28-27-20)13-18-8-4-5-9-19(18)23(31)26-21(15-30)16-6-2-1-3-7-16/h1-12,14,21,30H,13,15H2,(H2,24,25)(H,26,31)/t21-/m1/s1 |
| InChIKey | DRRCYMZNEXPXFD-OAQYLSRUSA-N |
| XLogP | 2.43 |
| TPSA | 118.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |