C10H9BrN2O2S2 — CID 167991202
3-[(2-bromo-4-methylphenyl)sulfonylmethyl]-1,2,5-thiadiazole (PubChem CID 167991202) has the molecular formula C10H9BrN2O2S2 and a molecular weight of 333.23 g/mol. Its IUPAC name is 3-[(2-bromo-4-methylphenyl)sulfonylmethyl]-1,2,5-thiadiazole.
| Compound Name | 3-[(2-bromo-4-methylphenyl)sulfonylmethyl]-1,2,5-thiadiazole |
|---|---|
| PubChem CID | 167991202 |
| Molecular Formula | C10H9BrN2O2S2 |
| Molecular Weight | 333.23 g/mol |
| Exact Mass | 331.93 |
| IUPAC Name | 3-[(2-bromo-4-methylphenyl)sulfonylmethyl]-1,2,5-thiadiazole |
| SMILES | Cc1ccc(S(=O)(=O)Cc2cnsn2)c(Br)c1 |
| InChI | InChI=1S/C10H9BrN2O2S2/c1-7-2-3-10(9(11)4-7)17(14,15)6-8-5-12-16-13-8/h2-5H,6H2,1H3 |
| InChIKey | FYVYZJJXHKXJRU-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.23 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |