C14H16N4O4S — CID 167991426
4-[5-(2,3-dihydro-1,4-benzodioxin-3-yl)-1H-1,2,4-triazol-3-yl]-1,4-thiazinane 1,1-dioxide (PubChem CID 167991426) has the molecular formula C14H16N4O4S and a molecular weight of 336.37 g/mol. Its IUPAC name is 4-[5-(2,3-dihydro-1,4-benzodioxin-3-yl)-1H-1,2,4-triazol-3-yl]-1,4-thiazinane 1,1-dioxide.
| Compound Name | 4-[5-(2,3-dihydro-1,4-benzodioxin-3-yl)-1H-1,2,4-triazol-3-yl]-1,4-thiazinane 1,1-dioxide |
|---|---|
| PubChem CID | 167991426 |
| Molecular Formula | C14H16N4O4S |
| Molecular Weight | 336.37 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | 4-[5-(2,3-dihydro-1,4-benzodioxin-3-yl)-1H-1,2,4-triazol-3-yl]-1,4-thiazinane 1,1-dioxide |
| SMILES | O=S1(=O)CCN(c2n[nH]c(C3COc4ccccc4O3)n2)CC1 |
| InChI | InChI=1S/C14H16N4O4S/c19-23(20)7-5-18(6-8-23)14-15-13(16-17-14)12-9-21-10-3-1-2-4-11(10)22-12/h1-4,12H,5-9H2,(H,15,16,17) |
| InChIKey | SKUWALUOEZYAQW-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.37 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |