C11H17F2NO — CID 167991718
4,4-difluoro-2-methyl-1-(4-methylidenepiperidin-1-yl)butan-1-one (PubChem CID 167991718) has the molecular formula C11H17F2NO and a molecular weight of 217.26 g/mol. Its IUPAC name is 4,4-difluoro-2-methyl-1-(4-methylidenepiperidin-1-yl)butan-1-one.
| Compound Name | 4,4-difluoro-2-methyl-1-(4-methylidenepiperidin-1-yl)butan-1-one |
|---|---|
| PubChem CID | 167991718 |
| Molecular Formula | C11H17F2NO |
| Molecular Weight | 217.26 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | 4,4-difluoro-2-methyl-1-(4-methylidenepiperidin-1-yl)butan-1-one |
| SMILES | C=C1CCN(C(=O)C(C)CC(F)F)CC1 |
| InChI | InChI=1S/C11H17F2NO/c1-8-3-5-14(6-4-8)11(15)9(2)7-10(12)13/h9-10H,1,3-7H2,2H3 |
| InChIKey | ZGRQSTFGRUNBMD-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.26 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|