C14H22F3NO — CID 126750316
2,2-dimethyl-1-[4-[(Z)-1,1,1-trifluorobut-2-en-2-yl]piperidin-1-yl]propan-1-one (PubChem CID 126750316) has the molecular formula C14H22F3NO and a molecular weight of 277.33 g/mol. Its IUPAC name is 2,2-dimethyl-1-[4-[(Z)-1,1,1-trifluorobut-2-en-2-yl]piperidin-1-yl]propan-1-one.
| Compound Name | 2,2-dimethyl-1-[4-[(Z)-1,1,1-trifluorobut-2-en-2-yl]piperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 126750316 |
| Molecular Formula | C14H22F3NO |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | 2,2-dimethyl-1-[4-[(Z)-1,1,1-trifluorobut-2-en-2-yl]piperidin-1-yl]propan-1-one |
| SMILES | C/C=C(/C1CCN(C(=O)C(C)(C)C)CC1)C(F)(F)F |
| InChI | InChI=1S/C14H22F3NO/c1-5-11(14(15,16)17)10-6-8-18(9-7-10)12(19)13(2,3)4/h5,10H,6-9H2,1-4H3/b11-5- |
| InChIKey | DCXSDXLIFMVDLB-WZUFQYTHSA-N |
| XLogP | 3.78 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|