About 2-ethyl-5-[[(2S,4S)-4-methoxy-1-methylpyrrolidin-2-yl]methyl-methylsulfamoyl]benzoic acid
2-ethyl-5-[[(2S,4S)-4-methoxy-1-methylpyrrolidin-2-yl]methyl-methylsulfamoyl]benzoic acid (PubChem CID 167992227) has the molecular formula C17H26N2O5S
and a molecular weight of 370.47 g/mol. Its IUPAC name is 2-ethyl-5-[[(2S,4S)-4-methoxy-1-methylpyrrolidin-2-yl]methyl-methylsulfamoyl]benzoic acid.
Molecular Properties
| Compound Name | 2-ethyl-5-[[(2S,4S)-4-methoxy-1-methylpyrrolidin-2-yl]methyl-methylsulfamoyl]benzoic acid |
| PubChem CID | 167992227 |
| Molecular Formula | C17H26N2O5S |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | 2-ethyl-5-[[(2S,4S)-4-methoxy-1-methylpyrrolidin-2-yl]methyl-methylsulfamoyl]benzoic acid |
| SMILES | CCc1ccc(S(=O)(=O)N(C)C[C@@H]2C[C@H](OC)CN2C)cc1C(=O)O |
| InChI | InChI=1S/C17H26N2O5S/c1-5-12-6-7-15(9-16(12)17(20)21)25(22,23)19(3)10-13-8-14(24-4)11-18(13)2/h6-7,9,13-14H,5,8,10-11H2,1-4H3,(H,20,21)/t13-,14-/m0/s1 |
| InChIKey | CEZCRLSXELIVOB-KBPBESRZSA-N |
| XLogP | 1.29 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-ethyl-5-[[(2S,4S)-4-methoxy-1-methylpyrrolidin-2-yl]methyl-methylsulfamoyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-5-[[(2S,4S)-4-methoxy-1-methylpyrrolidin-2-yl]methyl-methylsulfamoyl]benzoic acid?
The IUPAC name of 2-ethyl-5-[[(2S,4S)-4-methoxy-1-methylpyrrolidin-2-yl]methyl-methylsulfamoyl]benzoic acid (CID 167992227) is 2-ethyl-5-[[(2S,4S)-4-methoxy-1-methylpyrrolidin-2-yl]methyl-methylsulfamoyl]benzoic acid.
What is the SMILES notation for 2-ethyl-5-[[(2S,4S)-4-methoxy-1-methylpyrrolidin-2-yl]methyl-methylsulfamoyl]benzoic acid?
The canonical SMILES for 2-ethyl-5-[[(2S,4S)-4-methoxy-1-methylpyrrolidin-2-yl]methyl-methylsulfamoyl]benzoic acid is CCc1ccc(S(=O)(=O)N(C)C[C@@H]2C[C@H](OC)CN2C)cc1C(=O)O.
What is the InChIKey of 2-ethyl-5-[[(2S,4S)-4-methoxy-1-methylpyrrolidin-2-yl]methyl-methylsulfamoyl]benzoic acid?
The InChIKey is CEZCRLSXELIVOB-KBPBESRZSA-N. The full InChI is InChI=1S/C17H26N2O5S/c1-5-12-6-7-15(9-16(12)17(20)21)25(22,23)19(3)10-13-8-14(24-4)11-18(13)2/h6-7,9,13-14H,5,8,10-11H2,1-4H3,(H,20,21)/t13-,14-/m0/s1.
What are the key properties of 2-ethyl-5-[[(2S,4S)-4-methoxy-1-methylpyrrolidin-2-yl]methyl-methylsulfamoyl]benzoic acid?
2-ethyl-5-[[(2S,4S)-4-methoxy-1-methylpyrrolidin-2-yl]methyl-methylsulfamoyl]benzoic acid has a molecular weight of 370.47 g/mol, XLogP of 1.29, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-5-[[(2S,4S)-4-methoxy-1-methylpyrrolidin-2-yl]methyl-methylsulfamoyl]benzoic acid is sourced from PubChem (CID 167992227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).