C11H14ClNO4S — CID 167993137
2-chloro-N-(4-methoxy-2,3-dimethylphenyl)sulfonylacetamide (PubChem CID 167993137) has the molecular formula C11H14ClNO4S and a molecular weight of 291.76 g/mol. Its IUPAC name is 2-chloro-N-(4-methoxy-2,3-dimethylphenyl)sulfonylacetamide.
| Compound Name | 2-chloro-N-(4-methoxy-2,3-dimethylphenyl)sulfonylacetamide |
|---|---|
| PubChem CID | 167993137 |
| Molecular Formula | C11H14ClNO4S |
| Molecular Weight | 291.76 g/mol |
| Exact Mass | 291.03 |
| IUPAC Name | 2-chloro-N-(4-methoxy-2,3-dimethylphenyl)sulfonylacetamide |
| SMILES | COc1ccc(S(=O)(=O)NC(=O)CCl)c(C)c1C |
| InChI | InChI=1S/C11H14ClNO4S/c1-7-8(2)10(5-4-9(7)17-3)18(15,16)13-11(14)6-12/h4-5H,6H2,1-3H3,(H,13,14) |
| InChIKey | WMJMGTRZMDJQHD-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.76 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|