C17H14F2N2O2 — CID 167998872
1-(3-fluorophenyl)-4-[(4-fluorophenyl)methyl]piperazine-2,3-dione (PubChem CID 167998872) has the molecular formula C17H14F2N2O2 and a molecular weight of 316.31 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-4-[(4-fluorophenyl)methyl]piperazine-2,3-dione.
| Compound Name | 1-(3-fluorophenyl)-4-[(4-fluorophenyl)methyl]piperazine-2,3-dione |
|---|---|
| PubChem CID | 167998872 |
| Molecular Formula | C17H14F2N2O2 |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | 1-(3-fluorophenyl)-4-[(4-fluorophenyl)methyl]piperazine-2,3-dione |
| SMILES | O=C1C(=O)N(c2cccc(F)c2)CCN1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C17H14F2N2O2/c18-13-6-4-12(5-7-13)11-20-8-9-21(17(23)16(20)22)15-3-1-2-14(19)10-15/h1-7,10H,8-9,11H2 |
| InChIKey | MQYQEHOJSWCRFC-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|