C19H26N4O2 — CID 167999035
5-[2-(cyclohexen-1-yl)ethylimino]-6-ethyl-1,3-dimethyl-4aH-pyrido[2,3-d]pyrimidine-2,4-dione (PubChem CID 167999035) has the molecular formula C19H26N4O2 and a molecular weight of 342.44 g/mol. Its IUPAC name is 5-[2-(cyclohexen-1-yl)ethylimino]-6-ethyl-1,3-dimethyl-4aH-pyrido[2,3-d]pyrimidine-2,4-dione.
| Compound Name | 5-[2-(cyclohexen-1-yl)ethylimino]-6-ethyl-1,3-dimethyl-4aH-pyrido[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 167999035 |
| Molecular Formula | C19H26N4O2 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | 5-[2-(cyclohexen-1-yl)ethylimino]-6-ethyl-1,3-dimethyl-4aH-pyrido[2,3-d]pyrimidine-2,4-dione |
| SMILES | CCC1=CN=C2C(C(=O)N(C)C(=O)N2C)/C1=N/CCC1=CCCCC1 |
| InChI | InChI=1S/C19H26N4O2/c1-4-14-12-21-17-15(18(24)23(3)19(25)22(17)2)16(14)20-11-10-13-8-6-5-7-9-13/h8,12,15H,4-7,9-11H2,1-3H3/b20-16+ |
| InChIKey | IPUDRGLCKIMTTB-CAPFRKAQSA-N |
| XLogP | 3.16 |
| TPSA | 65.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|