C28H31N3O5 — CID 16802895
benzyl N-[2-(1,3-benzodioxol-5-yl)-2-[4-(4-methoxyphenyl)piperazin-1-yl]ethyl]carbamate (PubChem CID 16802895) has the molecular formula C28H31N3O5 and a molecular weight of 489.57 g/mol. Its IUPAC name is benzyl N-[2-(1,3-benzodioxol-5-yl)-2-[4-(4-methoxyphenyl)piperazin-1-yl]ethyl]carbamate.
| Compound Name | benzyl N-[2-(1,3-benzodioxol-5-yl)-2-[4-(4-methoxyphenyl)piperazin-1-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 16802895 |
| Molecular Formula | C28H31N3O5 |
| Molecular Weight | 489.57 g/mol |
| Exact Mass | 489.23 |
| IUPAC Name | benzyl N-[2-(1,3-benzodioxol-5-yl)-2-[4-(4-methoxyphenyl)piperazin-1-yl]ethyl]carbamate |
| SMILES | COc1ccc(N2CCN(C(CNC(=O)OCc3ccccc3)c3ccc4c(c3)OCO4)CC2)cc1 |
| InChI | InChI=1S/C28H31N3O5/c1-33-24-10-8-23(9-11-24)30-13-15-31(16-14-30)25(22-7-12-26-27(17-22)36-20-35-26)18-29-28(32)34-19-21-5-3-2-4-6-21/h2-12,17,25H,13-16,18-20H2,1H3,(H,29,32) |
| InChIKey | GJELOAYWOVMEMV-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 72.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.57 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|