C22H23N3O5S — CID 16820026
N-[2-[4-(furan-2-carbonyl)piperazin-1-yl]sulfonylethyl]naphthalene-1-carboxamide (PubChem CID 16820026) has the molecular formula C22H23N3O5S and a molecular weight of 441.51 g/mol. Its IUPAC name is N-[2-[4-(furan-2-carbonyl)piperazin-1-yl]sulfonylethyl]naphthalene-1-carboxamide.
| Compound Name | N-[2-[4-(furan-2-carbonyl)piperazin-1-yl]sulfonylethyl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 16820026 |
| Molecular Formula | C22H23N3O5S |
| Molecular Weight | 441.51 g/mol |
| Exact Mass | 441.14 |
| IUPAC Name | N-[2-[4-(furan-2-carbonyl)piperazin-1-yl]sulfonylethyl]naphthalene-1-carboxamide |
| SMILES | O=C(NCCS(=O)(=O)N1CCN(C(=O)c2ccco2)CC1)c1cccc2ccccc12 |
| InChI | InChI=1S/C22H23N3O5S/c26-21(19-8-3-6-17-5-1-2-7-18(17)19)23-10-16-31(28,29)25-13-11-24(12-14-25)22(27)20-9-4-15-30-20/h1-9,15H,10-14,16H2,(H,23,26) |
| InChIKey | GXBVPNLKEMKWPD-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.51 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |