C19H18ClN5O5 — CID 16841211
5-chloro-N-(1,3-dimethyl-2,4-dioxo-6-propan-2-ylpyrido[2,3-d]pyrimidin-5-yl)-2-nitrobenzamide (PubChem CID 16841211) has the molecular formula C19H18ClN5O5 and a molecular weight of 431.84 g/mol. Its IUPAC name is 5-chloro-N-(1,3-dimethyl-2,4-dioxo-6-propan-2-ylpyrido[2,3-d]pyrimidin-5-yl)-2-nitrobenzamide.
| Compound Name | 5-chloro-N-(1,3-dimethyl-2,4-dioxo-6-propan-2-ylpyrido[2,3-d]pyrimidin-5-yl)-2-nitrobenzamide |
|---|---|
| PubChem CID | 16841211 |
| Molecular Formula | C19H18ClN5O5 |
| Molecular Weight | 431.84 g/mol |
| Exact Mass | 431.10 |
| IUPAC Name | 5-chloro-N-(1,3-dimethyl-2,4-dioxo-6-propan-2-ylpyrido[2,3-d]pyrimidin-5-yl)-2-nitrobenzamide |
| SMILES | CC(C)c1cnc2c(c1NC(=O)c1cc(Cl)ccc1[N+](=O)[O-])c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C19H18ClN5O5/c1-9(2)12-8-21-16-14(18(27)24(4)19(28)23(16)3)15(12)22-17(26)11-7-10(20)5-6-13(11)25(29)30/h5-9H,1-4H3,(H,21,22,26) |
| InChIKey | PFKQCKBIUPVHLP-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 129.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.84 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|