C13H12ClN5O5 — CID 43935383
5-chloro-N'-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)-2-nitrobenzohydrazide (PubChem CID 43935383) has the molecular formula C13H12ClN5O5 and a molecular weight of 353.72 g/mol. Its IUPAC name is 5-chloro-N'-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)-2-nitrobenzohydrazide.
| Compound Name | 5-chloro-N'-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)-2-nitrobenzohydrazide |
|---|---|
| PubChem CID | 43935383 |
| Molecular Formula | C13H12ClN5O5 |
| Molecular Weight | 353.72 g/mol |
| Exact Mass | 353.05 |
| IUPAC Name | 5-chloro-N'-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)-2-nitrobenzohydrazide |
| SMILES | Cn1c(NNC(=O)c2cc(Cl)ccc2[N+](=O)[O-])cc(=O)n(C)c1=O |
| InChI | InChI=1S/C13H12ClN5O5/c1-17-10(6-11(20)18(2)13(17)22)15-16-12(21)8-5-7(14)3-4-9(8)19(23)24/h3-6,15H,1-2H3,(H,16,21) |
| InChIKey | PUVXYFRTEJLKAY-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 128.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.72 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|