C19H14Cl2N2O3S — CID 16848932
N-(4,7-dichloro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-2,5-dimethoxybenzamide (PubChem CID 16848932) has the molecular formula C19H14Cl2N2O3S and a molecular weight of 421.31 g/mol. Its IUPAC name is N-(4,7-dichloro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-2,5-dimethoxybenzamide.
| Compound Name | N-(4,7-dichloro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-2,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 16848932 |
| Molecular Formula | C19H14Cl2N2O3S |
| Molecular Weight | 421.31 g/mol |
| Exact Mass | 420.01 |
| IUPAC Name | N-(4,7-dichloro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-2,5-dimethoxybenzamide |
| SMILES | C#CCn1/c(=N/C(=O)c2cc(OC)ccc2OC)sc2c(Cl)ccc(Cl)c21 |
| InChI | InChI=1S/C19H14Cl2N2O3S/c1-4-9-23-16-13(20)6-7-14(21)17(16)27-19(23)22-18(24)12-10-11(25-2)5-8-15(12)26-3/h1,5-8,10H,9H2,2-3H3/b22-19- |
| InChIKey | APTJCSJKEXPPHF-QOCHGBHMSA-N |
| XLogP | 4.40 |
| TPSA | 52.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.31 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|