C17H12Cl2N2O3S2 — CID 16937425
(NZ)-N-(4,7-dichloro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-4-methoxybenzenesulfonamide (PubChem CID 16937425) has the molecular formula C17H12Cl2N2O3S2 and a molecular weight of 427.33 g/mol. Its IUPAC name is (NZ)-N-(4,7-dichloro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-4-methoxybenzenesulfonamide.
| Compound Name | (NZ)-N-(4,7-dichloro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 16937425 |
| Molecular Formula | C17H12Cl2N2O3S2 |
| Molecular Weight | 427.33 g/mol |
| Exact Mass | 425.97 |
| IUPAC Name | (NZ)-N-(4,7-dichloro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-4-methoxybenzenesulfonamide |
| SMILES | C#CCn1/c(=N/S(=O)(=O)c2ccc(OC)cc2)sc2c(Cl)ccc(Cl)c21 |
| InChI | InChI=1S/C17H12Cl2N2O3S2/c1-3-10-21-15-13(18)8-9-14(19)16(15)25-17(21)20-26(22,23)12-6-4-11(24-2)5-7-12/h1,4-9H,10H2,2H3/b20-17- |
| InChIKey | TUJNPACPPSITSG-JZJYNLBNSA-N |
| XLogP | 3.94 |
| TPSA | 60.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.33 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|