C13H9F2NO3 — CID 168501979
3-(4-ethynyl-2-oxopyrrolidin-1-yl)-2,6-difluorobenzoic acid (PubChem CID 168501979) has the molecular formula C13H9F2NO3 and a molecular weight of 265.21 g/mol. Its IUPAC name is 3-(4-ethynyl-2-oxopyrrolidin-1-yl)-2,6-difluorobenzoic acid.
| Compound Name | 3-(4-ethynyl-2-oxopyrrolidin-1-yl)-2,6-difluorobenzoic acid |
|---|---|
| PubChem CID | 168501979 |
| Molecular Formula | C13H9F2NO3 |
| Molecular Weight | 265.21 g/mol |
| Exact Mass | 265.06 |
| IUPAC Name | 3-(4-ethynyl-2-oxopyrrolidin-1-yl)-2,6-difluorobenzoic acid |
| SMILES | C#CC1CC(=O)N(c2ccc(F)c(C(=O)O)c2F)C1 |
| InChI | InChI=1S/C13H9F2NO3/c1-2-7-5-10(17)16(6-7)9-4-3-8(14)11(12(9)15)13(18)19/h1,3-4,7H,5-6H2,(H,18,19) |
| InChIKey | LEMGWIZXWYEXCG-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.21 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|