C13H9BrN2OS2 — CID 168502942
1-[4-(3-bromothiophen-2-yl)-1,3-thiazol-2-yl]-4-ethynylpyrrolidin-2-one (PubChem CID 168502942) has the molecular formula C13H9BrN2OS2 and a molecular weight of 353.27 g/mol. Its IUPAC name is 1-[4-(3-bromothiophen-2-yl)-1,3-thiazol-2-yl]-4-ethynylpyrrolidin-2-one.
| Compound Name | 1-[4-(3-bromothiophen-2-yl)-1,3-thiazol-2-yl]-4-ethynylpyrrolidin-2-one |
|---|---|
| PubChem CID | 168502942 |
| Molecular Formula | C13H9BrN2OS2 |
| Molecular Weight | 353.27 g/mol |
| Exact Mass | 351.93 |
| IUPAC Name | 1-[4-(3-bromothiophen-2-yl)-1,3-thiazol-2-yl]-4-ethynylpyrrolidin-2-one |
| SMILES | C#CC1CC(=O)N(c2nc(-c3sccc3Br)cs2)C1 |
| InChI | InChI=1S/C13H9BrN2OS2/c1-2-8-5-11(17)16(6-8)13-15-10(7-19-13)12-9(14)3-4-18-12/h1,3-4,7-8H,5-6H2 |
| InChIKey | JYNKSTDKJKKLDQ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.27 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|