C15H25BrN2O3 — CID 168503175
tert-butyl 2-[[4-(bromomethyl)-2-oxopyrrolidin-1-yl]methyl]pyrrolidine-1-carboxylate (PubChem CID 168503175) has the molecular formula C15H25BrN2O3 and a molecular weight of 361.28 g/mol. Its IUPAC name is tert-butyl 2-[[4-(bromomethyl)-2-oxopyrrolidin-1-yl]methyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[[4-(bromomethyl)-2-oxopyrrolidin-1-yl]methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 168503175 |
| Molecular Formula | C15H25BrN2O3 |
| Molecular Weight | 361.28 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | tert-butyl 2-[[4-(bromomethyl)-2-oxopyrrolidin-1-yl]methyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC1CN1CC(CBr)CC1=O |
| InChI | InChI=1S/C15H25BrN2O3/c1-15(2,3)21-14(20)18-6-4-5-12(18)10-17-9-11(8-16)7-13(17)19/h11-12H,4-10H2,1-3H3 |
| InChIKey | VTXQGBOBGVILTM-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.28 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|