C17H15ClN4O5S3 — CID 16850597
1-(5-chlorothiophen-2-yl)sulfonyl-N-(5-nitro-1,3-benzothiazol-2-yl)piperidine-2-carboxamide (PubChem CID 16850597) has the molecular formula C17H15ClN4O5S3 and a molecular weight of 486.98 g/mol. Its IUPAC name is 1-(5-chlorothiophen-2-yl)sulfonyl-N-(5-nitro-1,3-benzothiazol-2-yl)piperidine-2-carboxamide.
| Compound Name | 1-(5-chlorothiophen-2-yl)sulfonyl-N-(5-nitro-1,3-benzothiazol-2-yl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 16850597 |
| Molecular Formula | C17H15ClN4O5S3 |
| Molecular Weight | 486.98 g/mol |
| Exact Mass | 485.99 |
| IUPAC Name | 1-(5-chlorothiophen-2-yl)sulfonyl-N-(5-nitro-1,3-benzothiazol-2-yl)piperidine-2-carboxamide |
| SMILES | O=C(Nc1nc2cc([N+](=O)[O-])ccc2s1)C1CCCCN1S(=O)(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C17H15ClN4O5S3/c18-14-6-7-15(29-14)30(26,27)21-8-2-1-3-12(21)16(23)20-17-19-11-9-10(22(24)25)4-5-13(11)28-17/h4-7,9,12H,1-3,8H2,(H,19,20,23) |
| InChIKey | GXLBWHZAKXRIAG-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 122.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.98 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|