C20H19ClN4O5S3 — CID 16851881
1-(5-chlorothiophen-2-yl)sulfonyl-N-(5-nitro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)piperidine-2-carboxamide (PubChem CID 16851881) has the molecular formula C20H19ClN4O5S3 and a molecular weight of 527.05 g/mol. Its IUPAC name is 1-(5-chlorothiophen-2-yl)sulfonyl-N-(5-nitro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)piperidine-2-carboxamide.
| Compound Name | 1-(5-chlorothiophen-2-yl)sulfonyl-N-(5-nitro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 16851881 |
| Molecular Formula | C20H19ClN4O5S3 |
| Molecular Weight | 527.05 g/mol |
| Exact Mass | 526.02 |
| IUPAC Name | 1-(5-chlorothiophen-2-yl)sulfonyl-N-(5-nitro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)piperidine-2-carboxamide |
| SMILES | C=CCn1/c(=N/C(=O)C2CCCCN2S(=O)(=O)c2ccc(Cl)s2)sc2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C20H19ClN4O5S3/c1-2-10-23-15-12-13(25(27)28)6-7-16(15)31-20(23)22-19(26)14-5-3-4-11-24(14)33(29,30)18-9-8-17(21)32-18/h2,6-9,12,14H,1,3-5,10-11H2/b22-20- |
| InChIKey | YTNHTSNMLZMNPD-XDOYNYLZSA-N |
| XLogP | 4.18 |
| TPSA | 114.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.05 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|