C20H17ClN4O5S3 — CID 16852031
1-(5-chlorothiophen-2-yl)sulfonyl-N-(5-nitro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)piperidine-4-carboxamide (PubChem CID 16852031) has the molecular formula C20H17ClN4O5S3 and a molecular weight of 525.03 g/mol. Its IUPAC name is 1-(5-chlorothiophen-2-yl)sulfonyl-N-(5-nitro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)piperidine-4-carboxamide.
| Compound Name | 1-(5-chlorothiophen-2-yl)sulfonyl-N-(5-nitro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 16852031 |
| Molecular Formula | C20H17ClN4O5S3 |
| Molecular Weight | 525.03 g/mol |
| Exact Mass | 524.00 |
| IUPAC Name | 1-(5-chlorothiophen-2-yl)sulfonyl-N-(5-nitro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)piperidine-4-carboxamide |
| SMILES | C#CCn1/c(=N/C(=O)C2CCN(S(=O)(=O)c3ccc(Cl)s3)CC2)sc2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C20H17ClN4O5S3/c1-2-9-24-15-12-14(25(27)28)3-4-16(15)31-20(24)22-19(26)13-7-10-23(11-8-13)33(29,30)18-6-5-17(21)32-18/h1,3-6,12-13H,7-11H2/b22-20- |
| InChIKey | IZEMSYWCHVQIMH-XDOYNYLZSA-N |
| XLogP | 3.49 |
| TPSA | 114.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.03 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|