C20H18N4O5S3 — CID 16852068
N-(5-nitro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-1-thiophen-2-ylsulfonylpiperidine-2-carboxamide (PubChem CID 16852068) has the molecular formula C20H18N4O5S3 and a molecular weight of 490.59 g/mol. Its IUPAC name is N-(5-nitro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-1-thiophen-2-ylsulfonylpiperidine-2-carboxamide.
| Compound Name | N-(5-nitro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-1-thiophen-2-ylsulfonylpiperidine-2-carboxamide |
|---|---|
| PubChem CID | 16852068 |
| Molecular Formula | C20H18N4O5S3 |
| Molecular Weight | 490.59 g/mol |
| Exact Mass | 490.04 |
| IUPAC Name | N-(5-nitro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-1-thiophen-2-ylsulfonylpiperidine-2-carboxamide |
| SMILES | C#CCn1/c(=N/C(=O)C2CCCCN2S(=O)(=O)c2cccs2)sc2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C20H18N4O5S3/c1-2-10-22-16-13-14(24(26)27)8-9-17(16)31-20(22)21-19(25)15-6-3-4-11-23(15)32(28,29)18-7-5-12-30-18/h1,5,7-9,12-13,15H,3-4,6,10-11H2/b21-20- |
| InChIKey | DGMHTFKXDHUNHI-MRCUWXFGSA-N |
| XLogP | 2.98 |
| TPSA | 114.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.59 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|