C19H20N4O6S3 — CID 16851132
N-[3-(2-methoxyethyl)-5-nitro-1,3-benzothiazol-2-ylidene]-1-thiophen-2-ylsulfonylpyrrolidine-2-carboxamide (PubChem CID 16851132) has the molecular formula C19H20N4O6S3 and a molecular weight of 496.59 g/mol. Its IUPAC name is N-[3-(2-methoxyethyl)-5-nitro-1,3-benzothiazol-2-ylidene]-1-thiophen-2-ylsulfonylpyrrolidine-2-carboxamide.
| Compound Name | N-[3-(2-methoxyethyl)-5-nitro-1,3-benzothiazol-2-ylidene]-1-thiophen-2-ylsulfonylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 16851132 |
| Molecular Formula | C19H20N4O6S3 |
| Molecular Weight | 496.59 g/mol |
| Exact Mass | 496.05 |
| IUPAC Name | N-[3-(2-methoxyethyl)-5-nitro-1,3-benzothiazol-2-ylidene]-1-thiophen-2-ylsulfonylpyrrolidine-2-carboxamide |
| SMILES | COCCn1/c(=N/C(=O)C2CCCN2S(=O)(=O)c2cccs2)sc2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C19H20N4O6S3/c1-29-10-9-21-15-12-13(23(25)26)6-7-16(15)31-19(21)20-18(24)14-4-2-8-22(14)32(27,28)17-5-3-11-30-17/h3,5-7,11-12,14H,2,4,8-10H2,1H3/b20-19- |
| InChIKey | LBUPYPKRYGCKLP-VXPUYCOJSA-N |
| XLogP | 2.60 |
| TPSA | 124.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.59 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|