C11H14ClN3O3 — CID 168507145
ethyl 4-[4-(chloromethyl)-2-oxopyrrolidin-1-yl]-1H-pyrazole-5-carboxylate (PubChem CID 168507145) has the molecular formula C11H14ClN3O3 and a molecular weight of 271.70 g/mol. Its IUPAC name is ethyl 4-[4-(chloromethyl)-2-oxopyrrolidin-1-yl]-1H-pyrazole-5-carboxylate.
| Compound Name | ethyl 4-[4-(chloromethyl)-2-oxopyrrolidin-1-yl]-1H-pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 168507145 |
| Molecular Formula | C11H14ClN3O3 |
| Molecular Weight | 271.70 g/mol |
| Exact Mass | 271.07 |
| IUPAC Name | ethyl 4-[4-(chloromethyl)-2-oxopyrrolidin-1-yl]-1H-pyrazole-5-carboxylate |
| SMILES | CCOC(=O)c1[nH]ncc1N1CC(CCl)CC1=O |
| InChI | InChI=1S/C11H14ClN3O3/c1-2-18-11(17)10-8(5-13-14-10)15-6-7(4-12)3-9(15)16/h5,7H,2-4,6H2,1H3,(H,13,14) |
| InChIKey | URRYPWCEWVBSDO-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 75.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.70 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|