C13H15FN2O5S — CID 168675341
ethyl 3-[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]pyridine-4-carboxylate (PubChem CID 168675341) has the molecular formula C13H15FN2O5S and a molecular weight of 330.34 g/mol. Its IUPAC name is ethyl 3-[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]pyridine-4-carboxylate.
| Compound Name | ethyl 3-[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 168675341 |
| Molecular Formula | C13H15FN2O5S |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | ethyl 3-[4-(fluorosulfonylmethyl)-2-oxopyrrolidin-1-yl]pyridine-4-carboxylate |
| SMILES | CCOC(=O)c1ccncc1N1CC(CS(=O)(=O)F)CC1=O |
| InChI | InChI=1S/C13H15FN2O5S/c1-2-21-13(18)10-3-4-15-6-11(10)16-7-9(5-12(16)17)8-22(14,19)20/h3-4,6,9H,2,5,7-8H2,1H3 |
| InChIKey | GOEKVPRTJDIYQW-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 93.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |