C12H9Cl3N2O — CID 168508590
3,5-dichloro-4-[4-(chloromethyl)-2-oxopyrrolidin-1-yl]benzonitrile (PubChem CID 168508590) has the molecular formula C12H9Cl3N2O and a molecular weight of 303.58 g/mol. Its IUPAC name is 3,5-dichloro-4-[4-(chloromethyl)-2-oxopyrrolidin-1-yl]benzonitrile.
| Compound Name | 3,5-dichloro-4-[4-(chloromethyl)-2-oxopyrrolidin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 168508590 |
| Molecular Formula | C12H9Cl3N2O |
| Molecular Weight | 303.58 g/mol |
| Exact Mass | 301.98 |
| IUPAC Name | 3,5-dichloro-4-[4-(chloromethyl)-2-oxopyrrolidin-1-yl]benzonitrile |
| SMILES | N#Cc1cc(Cl)c(N2CC(CCl)CC2=O)c(Cl)c1 |
| InChI | InChI=1S/C12H9Cl3N2O/c13-4-8-3-11(18)17(6-8)12-9(14)1-7(5-16)2-10(12)15/h1-2,8H,3-4,6H2 |
| InChIKey | ZSABLECYLFUYEI-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.58 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|