C14H15ClN2O2 — CID 168509383
7-[4-(chloromethyl)-2-oxopyrrolidin-1-yl]-3,4-dihydro-1H-quinolin-2-one (PubChem CID 168509383) has the molecular formula C14H15ClN2O2 and a molecular weight of 278.74 g/mol. Its IUPAC name is 7-[4-(chloromethyl)-2-oxopyrrolidin-1-yl]-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 7-[4-(chloromethyl)-2-oxopyrrolidin-1-yl]-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 168509383 |
| Molecular Formula | C14H15ClN2O2 |
| Molecular Weight | 278.74 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | 7-[4-(chloromethyl)-2-oxopyrrolidin-1-yl]-3,4-dihydro-1H-quinolin-2-one |
| SMILES | O=C1CCc2ccc(N3CC(CCl)CC3=O)cc2N1 |
| InChI | InChI=1S/C14H15ClN2O2/c15-7-9-5-14(19)17(8-9)11-3-1-10-2-4-13(18)16-12(10)6-11/h1,3,6,9H,2,4-5,7-8H2,(H,16,18) |
| InChIKey | CZRSHBFGVOSBGW-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.74 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|