C17H12N4O4S — CID 16850986
N-(3-ethyl-5-nitro-1,3-benzothiazol-2-ylidene)-1,3-benzoxazole-2-carboxamide (PubChem CID 16850986) has the molecular formula C17H12N4O4S and a molecular weight of 368.37 g/mol. Its IUPAC name is N-(3-ethyl-5-nitro-1,3-benzothiazol-2-ylidene)-1,3-benzoxazole-2-carboxamide.
| Compound Name | N-(3-ethyl-5-nitro-1,3-benzothiazol-2-ylidene)-1,3-benzoxazole-2-carboxamide |
|---|---|
| PubChem CID | 16850986 |
| Molecular Formula | C17H12N4O4S |
| Molecular Weight | 368.37 g/mol |
| Exact Mass | 368.06 |
| IUPAC Name | N-(3-ethyl-5-nitro-1,3-benzothiazol-2-ylidene)-1,3-benzoxazole-2-carboxamide |
| SMILES | CCn1/c(=N/C(=O)c2nc3ccccc3o2)sc2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C17H12N4O4S/c1-2-20-12-9-10(21(23)24)7-8-14(12)26-17(20)19-15(22)16-18-11-5-3-4-6-13(11)25-16/h3-9H,2H2,1H3/b19-17- |
| InChIKey | VVHKOODXFISGTN-ZPHPHTNESA-N |
| XLogP | 3.51 |
| TPSA | 103.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.37 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|