C19H15FN2OS — CID 168510314
2-[[4-(aminomethyl)phenyl]methoxy]-4-(4-fluorophenyl)thiophene-3-carbonitrile (PubChem CID 168510314) has the molecular formula C19H15FN2OS and a molecular weight of 338.41 g/mol. Its IUPAC name is 2-[[4-(aminomethyl)phenyl]methoxy]-4-(4-fluorophenyl)thiophene-3-carbonitrile.
| Compound Name | 2-[[4-(aminomethyl)phenyl]methoxy]-4-(4-fluorophenyl)thiophene-3-carbonitrile |
|---|---|
| PubChem CID | 168510314 |
| Molecular Formula | C19H15FN2OS |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | 2-[[4-(aminomethyl)phenyl]methoxy]-4-(4-fluorophenyl)thiophene-3-carbonitrile |
| SMILES | N#Cc1c(-c2ccc(F)cc2)csc1OCc1ccc(CN)cc1 |
| InChI | InChI=1S/C19H15FN2OS/c20-16-7-5-15(6-8-16)18-12-24-19(17(18)10-22)23-11-14-3-1-13(9-21)2-4-14/h1-8,12H,9,11,21H2 |
| InChIKey | RMINZFWSLOOUSR-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 59.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |