C22H20Cl2N2O2S — CID 137403765
4-(3,4-dichlorophenyl)-2-[[3-[(2-methoxyethylamino)methyl]phenyl]methoxy]thiophene-3-carbonitrile (PubChem CID 137403765) has the molecular formula C22H20Cl2N2O2S and a molecular weight of 447.39 g/mol. Its IUPAC name is 4-(3,4-dichlorophenyl)-2-[[3-[(2-methoxyethylamino)methyl]phenyl]methoxy]thiophene-3-carbonitrile.
| Compound Name | 4-(3,4-dichlorophenyl)-2-[[3-[(2-methoxyethylamino)methyl]phenyl]methoxy]thiophene-3-carbonitrile |
|---|---|
| PubChem CID | 137403765 |
| Molecular Formula | C22H20Cl2N2O2S |
| Molecular Weight | 447.39 g/mol |
| Exact Mass | 446.06 |
| IUPAC Name | 4-(3,4-dichlorophenyl)-2-[[3-[(2-methoxyethylamino)methyl]phenyl]methoxy]thiophene-3-carbonitrile |
| SMILES | COCCNCc1cccc(COc2scc(-c3ccc(Cl)c(Cl)c3)c2C#N)c1 |
| InChI | InChI=1S/C22H20Cl2N2O2S/c1-27-8-7-26-12-15-3-2-4-16(9-15)13-28-22-18(11-25)19(14-29-22)17-5-6-20(23)21(24)10-17/h2-6,9-10,14,26H,7-8,12-13H2,1H3 |
| InChIKey | CFQWUBIIONXNBP-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 54.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.39 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|