C24H24N2O3S2 — CID 137404248
4-(1,3-benzodioxol-5-yl)-2-[[4-[(3-methylsulfanylpropylamino)methyl]phenyl]methoxy]thiophene-3-carbonitrile (PubChem CID 137404248) has the molecular formula C24H24N2O3S2 and a molecular weight of 452.60 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-yl)-2-[[4-[(3-methylsulfanylpropylamino)methyl]phenyl]methoxy]thiophene-3-carbonitrile.
| Compound Name | 4-(1,3-benzodioxol-5-yl)-2-[[4-[(3-methylsulfanylpropylamino)methyl]phenyl]methoxy]thiophene-3-carbonitrile |
|---|---|
| PubChem CID | 137404248 |
| Molecular Formula | C24H24N2O3S2 |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.12 |
| IUPAC Name | 4-(1,3-benzodioxol-5-yl)-2-[[4-[(3-methylsulfanylpropylamino)methyl]phenyl]methoxy]thiophene-3-carbonitrile |
| SMILES | CSCCCNCc1ccc(COc2scc(-c3ccc4c(c3)OCO4)c2C#N)cc1 |
| InChI | InChI=1S/C24H24N2O3S2/c1-30-10-2-9-26-13-17-3-5-18(6-4-17)14-27-24-20(12-25)21(15-31-24)19-7-8-22-23(11-19)29-16-28-22/h3-8,11,15,26H,2,9-10,13-14,16H2,1H3 |
| InChIKey | XTILFWYYRNNCMH-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 63.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|