C17H11FN4O2 — CID 168518299
2-[2-fluoro-4-(4-methyltriazol-1-yl)phenyl]isoindole-1,3-dione (PubChem CID 168518299) has the molecular formula C17H11FN4O2 and a molecular weight of 322.30 g/mol. Its IUPAC name is 2-[2-fluoro-4-(4-methyltriazol-1-yl)phenyl]isoindole-1,3-dione.
| Compound Name | 2-[2-fluoro-4-(4-methyltriazol-1-yl)phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 168518299 |
| Molecular Formula | C17H11FN4O2 |
| Molecular Weight | 322.30 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | 2-[2-fluoro-4-(4-methyltriazol-1-yl)phenyl]isoindole-1,3-dione |
| SMILES | Cc1cn(-c2ccc(N3C(=O)c4ccccc4C3=O)c(F)c2)nn1 |
| InChI | InChI=1S/C17H11FN4O2/c1-10-9-21(20-19-10)11-6-7-15(14(18)8-11)22-16(23)12-4-2-3-5-13(12)17(22)24/h2-9H,1H3 |
| InChIKey | NFKGZMMDNPBUQK-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.30 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|