C20H18N2O3 — CID 168519312
2-[3-methyl-4-(2-oxopiperidin-1-yl)phenyl]isoindole-1,3-dione (PubChem CID 168519312) has the molecular formula C20H18N2O3 and a molecular weight of 334.38 g/mol. Its IUPAC name is 2-[3-methyl-4-(2-oxopiperidin-1-yl)phenyl]isoindole-1,3-dione.
| Compound Name | 2-[3-methyl-4-(2-oxopiperidin-1-yl)phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 168519312 |
| Molecular Formula | C20H18N2O3 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | 2-[3-methyl-4-(2-oxopiperidin-1-yl)phenyl]isoindole-1,3-dione |
| SMILES | Cc1cc(N2C(=O)c3ccccc3C2=O)ccc1N1CCCCC1=O |
| InChI | InChI=1S/C20H18N2O3/c1-13-12-14(9-10-17(13)21-11-5-4-8-18(21)23)22-19(24)15-6-2-3-7-16(15)20(22)25/h2-3,6-7,9-10,12H,4-5,8,11H2,1H3 |
| InChIKey | JJHWQGJKNYJIRN-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|