C14H13N3O2 — CID 168522003
2-cyano-N-(4,6-dimethyl-2-oxo-1H-quinolin-7-yl)acetamide (PubChem CID 168522003) has the molecular formula C14H13N3O2 and a molecular weight of 255.28 g/mol. Its IUPAC name is 2-cyano-N-(4,6-dimethyl-2-oxo-1H-quinolin-7-yl)acetamide.
| Compound Name | 2-cyano-N-(4,6-dimethyl-2-oxo-1H-quinolin-7-yl)acetamide |
|---|---|
| PubChem CID | 168522003 |
| Molecular Formula | C14H13N3O2 |
| Molecular Weight | 255.28 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | 2-cyano-N-(4,6-dimethyl-2-oxo-1H-quinolin-7-yl)acetamide |
| SMILES | Cc1cc2c(C)cc(=O)[nH]c2cc1NC(=O)CC#N |
| InChI | InChI=1S/C14H13N3O2/c1-8-6-14(19)17-12-7-11(9(2)5-10(8)12)16-13(18)3-4-15/h5-7H,3H2,1-2H3,(H,16,18)(H,17,19) |
| InChIKey | YZGBPRBEGXEAEI-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 85.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.28 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |