C14H11FN2O3 — CID 168522972
2-cyano-N-[5-fluoro-2-(furan-2-ylmethoxy)phenyl]acetamide (PubChem CID 168522972) has the molecular formula C14H11FN2O3 and a molecular weight of 274.25 g/mol. Its IUPAC name is 2-cyano-N-[5-fluoro-2-(furan-2-ylmethoxy)phenyl]acetamide.
| Compound Name | 2-cyano-N-[5-fluoro-2-(furan-2-ylmethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 168522972 |
| Molecular Formula | C14H11FN2O3 |
| Molecular Weight | 274.25 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | 2-cyano-N-[5-fluoro-2-(furan-2-ylmethoxy)phenyl]acetamide |
| SMILES | N#CCC(=O)Nc1cc(F)ccc1OCc1ccco1 |
| InChI | InChI=1S/C14H11FN2O3/c15-10-3-4-13(20-9-11-2-1-7-19-11)12(8-10)17-14(18)5-6-16/h1-4,7-8H,5,9H2,(H,17,18) |
| InChIKey | YLONAQYPVVPFPY-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 75.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.25 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |