C10H7F3N2O3S — CID 168523787
2-cyano-N-[2-(difluoromethylsulfonyl)-4-fluorophenyl]acetamide (PubChem CID 168523787) has the molecular formula C10H7F3N2O3S and a molecular weight of 292.24 g/mol. Its IUPAC name is 2-cyano-N-[2-(difluoromethylsulfonyl)-4-fluorophenyl]acetamide.
| Compound Name | 2-cyano-N-[2-(difluoromethylsulfonyl)-4-fluorophenyl]acetamide |
|---|---|
| PubChem CID | 168523787 |
| Molecular Formula | C10H7F3N2O3S |
| Molecular Weight | 292.24 g/mol |
| Exact Mass | 292.01 |
| IUPAC Name | 2-cyano-N-[2-(difluoromethylsulfonyl)-4-fluorophenyl]acetamide |
| SMILES | N#CCC(=O)Nc1ccc(F)cc1S(=O)(=O)C(F)F |
| InChI | InChI=1S/C10H7F3N2O3S/c11-6-1-2-7(15-9(16)3-4-14)8(5-6)19(17,18)10(12)13/h1-2,5,10H,3H2,(H,15,16) |
| InChIKey | ABLSPWQPVBWGTL-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 87.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.24 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |