C13H8F6O2 — CID 168524391
1,1,1,3,3,3-hexafluoro-2-[4-(furan-2-yl)phenyl]propan-2-ol (PubChem CID 168524391) has the molecular formula C13H8F6O2 and a molecular weight of 310.19 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-[4-(furan-2-yl)phenyl]propan-2-ol.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-[4-(furan-2-yl)phenyl]propan-2-ol |
|---|---|
| PubChem CID | 168524391 |
| Molecular Formula | C13H8F6O2 |
| Molecular Weight | 310.19 g/mol |
| Exact Mass | 310.04 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-[4-(furan-2-yl)phenyl]propan-2-ol |
| SMILES | OC(c1ccc(-c2ccco2)cc1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C13H8F6O2/c14-12(15,16)11(20,13(17,18)19)9-5-3-8(4-6-9)10-2-1-7-21-10/h1-7,20H |
| InChIKey | PDGCHLVKQBCLOJ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.19 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |