C12H10Br2O — CID 168524606
2-(2,6-dibromo-3,4-dimethylphenyl)furan (PubChem CID 168524606) has the molecular formula C12H10Br2O and a molecular weight of 330.02 g/mol. Its IUPAC name is 2-(2,6-dibromo-3,4-dimethylphenyl)furan.
| Compound Name | 2-(2,6-dibromo-3,4-dimethylphenyl)furan |
|---|---|
| PubChem CID | 168524606 |
| Molecular Formula | C12H10Br2O |
| Molecular Weight | 330.02 g/mol |
| Exact Mass | 327.91 |
| IUPAC Name | 2-(2,6-dibromo-3,4-dimethylphenyl)furan |
| SMILES | Cc1cc(Br)c(-c2ccco2)c(Br)c1C |
| InChI | InChI=1S/C12H10Br2O/c1-7-6-9(13)11(12(14)8(7)2)10-4-3-5-15-10/h3-6H,1-2H3 |
| InChIKey | IYHUIEPFBJWFJI-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.02 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |