C11H4Br2F2O3 — CID 168525408
4,6-dibromo-2,2-difluoro-5-(furan-2-yl)-1,3-benzodioxole (PubChem CID 168525408) has the molecular formula C11H4Br2F2O3 and a molecular weight of 381.95 g/mol. Its IUPAC name is 4,6-dibromo-2,2-difluoro-5-(furan-2-yl)-1,3-benzodioxole.
| Compound Name | 4,6-dibromo-2,2-difluoro-5-(furan-2-yl)-1,3-benzodioxole |
|---|---|
| PubChem CID | 168525408 |
| Molecular Formula | C11H4Br2F2O3 |
| Molecular Weight | 381.95 g/mol |
| Exact Mass | 379.85 |
| IUPAC Name | 4,6-dibromo-2,2-difluoro-5-(furan-2-yl)-1,3-benzodioxole |
| SMILES | FC1(F)Oc2cc(Br)c(-c3ccco3)c(Br)c2O1 |
| InChI | InChI=1S/C11H4Br2F2O3/c12-5-4-7-10(18-11(14,15)17-7)9(13)8(5)6-2-1-3-16-6/h1-4H |
| InChIKey | WUNAOUZDPJKENC-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 31.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.95 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |