C14H14N2O5S — CID 168524836
N-cyclopropyl-3-(furan-2-yl)-4-methyl-5-nitrobenzenesulfonamide (PubChem CID 168524836) has the molecular formula C14H14N2O5S and a molecular weight of 322.34 g/mol. Its IUPAC name is N-cyclopropyl-3-(furan-2-yl)-4-methyl-5-nitrobenzenesulfonamide.
| Compound Name | N-cyclopropyl-3-(furan-2-yl)-4-methyl-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 168524836 |
| Molecular Formula | C14H14N2O5S |
| Molecular Weight | 322.34 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | N-cyclopropyl-3-(furan-2-yl)-4-methyl-5-nitrobenzenesulfonamide |
| SMILES | Cc1c(-c2ccco2)cc(S(=O)(=O)NC2CC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H14N2O5S/c1-9-12(14-3-2-6-21-14)7-11(8-13(9)16(17)18)22(19,20)15-10-4-5-10/h2-3,6-8,10,15H,4-5H2,1H3 |
| InChIKey | CPJODHPATYGVCQ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 102.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.34 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|