C16H10N2O2 — CID 168526083
2-[4-(furan-2-yl)phenyl]-[1,3]oxazolo[4,5-b]pyridine (PubChem CID 168526083) has the molecular formula C16H10N2O2 and a molecular weight of 262.27 g/mol. Its IUPAC name is 2-[4-(furan-2-yl)phenyl]-[1,3]oxazolo[4,5-b]pyridine.
| Compound Name | 2-[4-(furan-2-yl)phenyl]-[1,3]oxazolo[4,5-b]pyridine |
|---|---|
| PubChem CID | 168526083 |
| Molecular Formula | C16H10N2O2 |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.07 |
| IUPAC Name | 2-[4-(furan-2-yl)phenyl]-[1,3]oxazolo[4,5-b]pyridine |
| SMILES | c1coc(-c2ccc(-c3nc4ncccc4o3)cc2)c1 |
| InChI | InChI=1S/C16H10N2O2/c1-3-14-15(17-9-1)18-16(20-14)12-7-5-11(6-8-12)13-4-2-10-19-13/h1-10H |
| InChIKey | BJFINDPIYPEIPW-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 52.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |