C21H17NOS — CID 168527485
4-(2,4-dimethylphenyl)-2-[3-(furan-2-yl)phenyl]-1,3-thiazole (PubChem CID 168527485) has the molecular formula C21H17NOS and a molecular weight of 331.44 g/mol. Its IUPAC name is 4-(2,4-dimethylphenyl)-2-[3-(furan-2-yl)phenyl]-1,3-thiazole.
| Compound Name | 4-(2,4-dimethylphenyl)-2-[3-(furan-2-yl)phenyl]-1,3-thiazole |
|---|---|
| PubChem CID | 168527485 |
| Molecular Formula | C21H17NOS |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | 4-(2,4-dimethylphenyl)-2-[3-(furan-2-yl)phenyl]-1,3-thiazole |
| SMILES | Cc1ccc(-c2csc(-c3cccc(-c4ccco4)c3)n2)c(C)c1 |
| InChI | InChI=1S/C21H17NOS/c1-14-8-9-18(15(2)11-14)19-13-24-21(22-19)17-6-3-5-16(12-17)20-7-4-10-23-20/h3-13H,1-2H3 |
| InChIKey | YDFKGKOCWAVALH-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |