C10H14N2O2 — CID 168529705
2-methanehydrazonoyl-4-methoxy-3,6-dimethylphenol (PubChem CID 168529705) has the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. Its IUPAC name is 2-methanehydrazonoyl-4-methoxy-3,6-dimethylphenol.
| Compound Name | 2-methanehydrazonoyl-4-methoxy-3,6-dimethylphenol |
|---|---|
| PubChem CID | 168529705 |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | 2-methanehydrazonoyl-4-methoxy-3,6-dimethylphenol |
| SMILES | COc1cc(C)c(O)c(C=NN)c1C |
| InChI | InChI=1S/C10H14N2O2/c1-6-4-9(14-3)7(2)8(5-12-11)10(6)13/h4-5,13H,11H2,1-3H3 |
| InChIKey | LYUSOIGFOCQFLA-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|