C14H14N2O4 — CID 168530496
(2-ethoxy-4-methanehydrazonoylphenyl) furan-2-carboxylate (PubChem CID 168530496) has the molecular formula C14H14N2O4 and a molecular weight of 274.28 g/mol. Its IUPAC name is (2-ethoxy-4-methanehydrazonoylphenyl) furan-2-carboxylate.
| Compound Name | (2-ethoxy-4-methanehydrazonoylphenyl) furan-2-carboxylate |
|---|---|
| PubChem CID | 168530496 |
| Molecular Formula | C14H14N2O4 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | (2-ethoxy-4-methanehydrazonoylphenyl) furan-2-carboxylate |
| SMILES | CCOc1cc(C=NN)ccc1OC(=O)c1ccco1 |
| InChI | InChI=1S/C14H14N2O4/c1-2-18-13-8-10(9-16-15)5-6-11(13)20-14(17)12-4-3-7-19-12/h3-9H,2,15H2,1H3 |
| InChIKey | GOXARUHJOLFVAQ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 87.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|